C18H23N5O3S — CID 121118591
1-(6-methylpyridazin-3-yl)-N-[(4-sulfamoylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 121118591) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is 1-(6-methylpyridazin-3-yl)-N-[(4-sulfamoylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(6-methylpyridazin-3-yl)-N-[(4-sulfamoylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121118591 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1-(6-methylpyridazin-3-yl)-N-[(4-sulfamoylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(N2CCCC(C(=O)NCc3ccc(S(N)(=O)=O)cc3)C2)nn1 |
| InChI | InChI=1S/C18H23N5O3S/c1-13-4-9-17(22-21-13)23-10-2-3-15(12-23)18(24)20-11-14-5-7-16(8-6-14)27(19,25)26/h4-9,15H,2-3,10-12H2,1H3,(H,20,24)(H2,19,25,26) |
| InChIKey | KTFNUOHKOSKMFB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |