C22H25IN6O — CID 90514647
1-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]-N-[(4-iodophenyl)methyl]piperidine-3-carboxamide (PubChem CID 90514647) has the molecular formula C22H25IN6O and a molecular weight of 516.39 g/mol. Its IUPAC name is 1-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]-N-[(4-iodophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]-N-[(4-iodophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 90514647 |
| Molecular Formula | C22H25IN6O |
| Molecular Weight | 516.39 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 1-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]-N-[(4-iodophenyl)methyl]piperidine-3-carboxamide |
| SMILES | Cc1cc(C)n(-c2ccc(N3CCCC(C(=O)NCc4ccc(I)cc4)C3)nn2)n1 |
| InChI | InChI=1S/C22H25IN6O/c1-15-12-16(2)29(27-15)21-10-9-20(25-26-21)28-11-3-4-18(14-28)22(30)24-13-17-5-7-19(23)8-6-17/h5-10,12,18H,3-4,11,13-14H2,1-2H3,(H,24,30) |
| InChIKey | OZOWFSAXTFMXNO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|