C15H15N5O3 — CID 121119296
5-(furan-2-yl)-N-[2-(4-methyl-6-oxopyrimidin-1-yl)ethyl]-1H-pyrazole-3-carboxamide (PubChem CID 121119296) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-[2-(4-methyl-6-oxopyrimidin-1-yl)ethyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-[2-(4-methyl-6-oxopyrimidin-1-yl)ethyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 121119296 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 5-(furan-2-yl)-N-[2-(4-methyl-6-oxopyrimidin-1-yl)ethyl]-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(=O)n(CCNC(=O)c2cc(-c3ccco3)[nH]n2)cn1 |
| InChI | InChI=1S/C15H15N5O3/c1-10-7-14(21)20(9-17-10)5-4-16-15(22)12-8-11(18-19-12)13-3-2-6-23-13/h2-3,6-9H,4-5H2,1H3,(H,16,22)(H,18,19) |
| InChIKey | LJCXLCBUWNXJPQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |