C20H17N5O3 — CID 90515676
5-(furan-2-yl)-N-[2-(6-oxo-4-phenylpyrimidin-1-yl)ethyl]-1H-pyrazole-3-carboxamide (PubChem CID 90515676) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-[2-(6-oxo-4-phenylpyrimidin-1-yl)ethyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-[2-(6-oxo-4-phenylpyrimidin-1-yl)ethyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 90515676 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 5-(furan-2-yl)-N-[2-(6-oxo-4-phenylpyrimidin-1-yl)ethyl]-1H-pyrazole-3-carboxamide |
| SMILES | O=C(NCCn1cnc(-c2ccccc2)cc1=O)c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C20H17N5O3/c26-19-12-15(14-5-2-1-3-6-14)22-13-25(19)9-8-21-20(27)17-11-16(23-24-17)18-7-4-10-28-18/h1-7,10-13H,8-9H2,(H,21,27)(H,23,24) |
| InChIKey | WQTUQZRMUAWDCE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |