C19H21N5O3 — CID 121119799
N-[2-(4-ethyl-6-oxopyrimidin-1-yl)ethyl]-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 121119799) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[2-(4-ethyl-6-oxopyrimidin-1-yl)ethyl]-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[2-(4-ethyl-6-oxopyrimidin-1-yl)ethyl]-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 121119799 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[2-(4-ethyl-6-oxopyrimidin-1-yl)ethyl]-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | CCc1cc(=O)n(CCNC(=O)c2cc(-c3ccccc3OC)n[nH]2)cn1 |
| InChI | InChI=1S/C19H21N5O3/c1-3-13-10-18(25)24(12-21-13)9-8-20-19(26)16-11-15(22-23-16)14-6-4-5-7-17(14)27-2/h4-7,10-12H,3,8-9H2,1-2H3,(H,20,26)(H,22,23) |
| InChIKey | YEUQCCKIOYAPBC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |