C17H22N4O3 — CID 121119868
1-[2-(4-ethyl-6-oxopyrimidin-1-yl)ethyl]-3-[(4-methoxyphenyl)methyl]urea (PubChem CID 121119868) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-[2-(4-ethyl-6-oxopyrimidin-1-yl)ethyl]-3-[(4-methoxyphenyl)methyl]urea.
| Compound Name | 1-[2-(4-ethyl-6-oxopyrimidin-1-yl)ethyl]-3-[(4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 121119868 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-[2-(4-ethyl-6-oxopyrimidin-1-yl)ethyl]-3-[(4-methoxyphenyl)methyl]urea |
| SMILES | CCc1cc(=O)n(CCNC(=O)NCc2ccc(OC)cc2)cn1 |
| InChI | InChI=1S/C17H22N4O3/c1-3-14-10-16(22)21(12-20-14)9-8-18-17(23)19-11-13-4-6-15(24-2)7-5-13/h4-7,10,12H,3,8-9,11H2,1-2H3,(H2,18,19,23) |
| InChIKey | TWPYPWJANYWQRR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |