C26H29N3O2 — CID 121120312
N-[2-(4-cyclopentyl-6-oxopyrimidin-1-yl)ethyl]-3,3-diphenylpropanamide (PubChem CID 121120312) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[2-(4-cyclopentyl-6-oxopyrimidin-1-yl)ethyl]-3,3-diphenylpropanamide.
| Compound Name | N-[2-(4-cyclopentyl-6-oxopyrimidin-1-yl)ethyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 121120312 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-[2-(4-cyclopentyl-6-oxopyrimidin-1-yl)ethyl]-3,3-diphenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)NCCn1cnc(C2CCCC2)cc1=O |
| InChI | InChI=1S/C26H29N3O2/c30-25(17-23(20-9-3-1-4-10-20)21-11-5-2-6-12-21)27-15-16-29-19-28-24(18-26(29)31)22-13-7-8-14-22/h1-6,9-12,18-19,22-23H,7-8,13-17H2,(H,27,30) |
| InChIKey | DUSGPNXYYPSSIP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |