C19H24N4O2 — CID 121120589
1-[2-(4-cyclopentyl-6-oxopyrimidin-1-yl)ethyl]-3-(2-methylphenyl)urea (PubChem CID 121120589) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-[2-(4-cyclopentyl-6-oxopyrimidin-1-yl)ethyl]-3-(2-methylphenyl)urea.
| Compound Name | 1-[2-(4-cyclopentyl-6-oxopyrimidin-1-yl)ethyl]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 121120589 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-[2-(4-cyclopentyl-6-oxopyrimidin-1-yl)ethyl]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NCCn1cnc(C2CCCC2)cc1=O |
| InChI | InChI=1S/C19H24N4O2/c1-14-6-2-5-9-16(14)22-19(25)20-10-11-23-13-21-17(12-18(23)24)15-7-3-4-8-15/h2,5-6,9,12-13,15H,3-4,7-8,10-11H2,1H3,(H2,20,22,25) |
| InChIKey | QUIJDERXLZNWON-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |