C18H23N3O4 — CID 121121042
3,4-diethoxy-N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]benzamide (PubChem CID 121121042) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3,4-diethoxy-N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 121121042 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3,4-diethoxy-N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCCn2cncc(C)c2=O)cc1OCC |
| InChI | InChI=1S/C18H23N3O4/c1-4-24-15-7-6-14(10-16(15)25-5-2)17(22)20-8-9-21-12-19-11-13(3)18(21)23/h6-7,10-12H,4-5,8-9H2,1-3H3,(H,20,22) |
| InChIKey | RXCXNGYXZFJXMA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |