C17H19N5O3 — CID 121121318
3-methoxy-2-methyl-N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]indazole-6-carboxamide (PubChem CID 121121318) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-methoxy-2-methyl-N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]indazole-6-carboxamide.
| Compound Name | 3-methoxy-2-methyl-N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]indazole-6-carboxamide |
|---|---|
| PubChem CID | 121121318 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3-methoxy-2-methyl-N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]indazole-6-carboxamide |
| SMILES | COc1c2ccc(C(=O)NCCn3cncc(C)c3=O)cc2nn1C |
| InChI | InChI=1S/C17H19N5O3/c1-11-9-18-10-22(16(11)24)7-6-19-15(23)12-4-5-13-14(8-12)20-21(2)17(13)25-3/h4-5,8-10H,6-7H2,1-3H3,(H,19,23) |
| InChIKey | QMFSGNBMTLYXHI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |