C13H13F2NO3S — CID 121127112
2,4-difluoro-N-[1-(furan-3-yl)propan-2-yl]benzenesulfonamide (PubChem CID 121127112) has the molecular formula C13H13F2NO3S and a molecular weight of 301.31 g/mol. Its IUPAC name is 2,4-difluoro-N-[1-(furan-3-yl)propan-2-yl]benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-[1-(furan-3-yl)propan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 121127112 |
| Molecular Formula | C13H13F2NO3S |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2,4-difluoro-N-[1-(furan-3-yl)propan-2-yl]benzenesulfonamide |
| SMILES | CC(Cc1ccoc1)NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H13F2NO3S/c1-9(6-10-4-5-19-8-10)16-20(17,18)13-3-2-11(14)7-12(13)15/h2-5,7-9,16H,6H2,1H3 |
| InChIKey | MZWNQNQVHRCXSW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |