C14H15ClN2O2 — CID 121127180
1-(2-chlorophenyl)-3-[1-(furan-3-yl)propan-2-yl]urea (PubChem CID 121127180) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[1-(furan-3-yl)propan-2-yl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[1-(furan-3-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 121127180 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[1-(furan-3-yl)propan-2-yl]urea |
| SMILES | CC(Cc1ccoc1)NC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C14H15ClN2O2/c1-10(8-11-6-7-19-9-11)16-14(18)17-13-5-3-2-4-12(13)15/h2-7,9-10H,8H2,1H3,(H2,16,17,18) |
| InChIKey | TVRXSLFJNIFBIT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |