C16H17N3O3S2 — CID 121128046
1-(4-methoxy-1,3-benzothiazol-2-yl)-N-(2-oxothiolan-3-yl)azetidine-3-carboxamide (PubChem CID 121128046) has the molecular formula C16H17N3O3S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-(4-methoxy-1,3-benzothiazol-2-yl)-N-(2-oxothiolan-3-yl)azetidine-3-carboxamide.
| Compound Name | 1-(4-methoxy-1,3-benzothiazol-2-yl)-N-(2-oxothiolan-3-yl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 121128046 |
| Molecular Formula | C16H17N3O3S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 1-(4-methoxy-1,3-benzothiazol-2-yl)-N-(2-oxothiolan-3-yl)azetidine-3-carboxamide |
| SMILES | COc1cccc2sc(N3CC(C(=O)NC4CCSC4=O)C3)nc12 |
| InChI | InChI=1S/C16H17N3O3S2/c1-22-11-3-2-4-12-13(11)18-16(24-12)19-7-9(8-19)14(20)17-10-5-6-23-15(10)21/h2-4,9-10H,5-8H2,1H3,(H,17,20) |
| InChIKey | RKBRIHAUHCPNPF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|