C15H19N3O3S — CID 121127887
1-(4-methoxy-1,3-benzothiazol-2-yl)-N-(2-methoxyethyl)azetidine-3-carboxamide (PubChem CID 121127887) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-(4-methoxy-1,3-benzothiazol-2-yl)-N-(2-methoxyethyl)azetidine-3-carboxamide.
| Compound Name | 1-(4-methoxy-1,3-benzothiazol-2-yl)-N-(2-methoxyethyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 121127887 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-(4-methoxy-1,3-benzothiazol-2-yl)-N-(2-methoxyethyl)azetidine-3-carboxamide |
| SMILES | COCCNC(=O)C1CN(c2nc3c(OC)cccc3s2)C1 |
| InChI | InChI=1S/C15H19N3O3S/c1-20-7-6-16-14(19)10-8-18(9-10)15-17-13-11(21-2)4-3-5-12(13)22-15/h3-5,10H,6-9H2,1-2H3,(H,16,19) |
| InChIKey | PJOUHTJUHCZRDV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|