C24H27NO2S — CID 121131582
2-(4-propan-2-ylsulfanylphenyl)-N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]acetamide (PubChem CID 121131582) has the molecular formula C24H27NO2S and a molecular weight of 393.55 g/mol. Its IUPAC name is 2-(4-propan-2-ylsulfanylphenyl)-N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]acetamide.
| Compound Name | 2-(4-propan-2-ylsulfanylphenyl)-N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]acetamide |
|---|---|
| PubChem CID | 121131582 |
| Molecular Formula | C24H27NO2S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-(4-propan-2-ylsulfanylphenyl)-N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]acetamide |
| SMILES | C=CCc1ccccc1OCC#CCNC(=O)Cc1ccc(SC(C)C)cc1 |
| InChI | InChI=1S/C24H27NO2S/c1-4-9-21-10-5-6-11-23(21)27-17-8-7-16-25-24(26)18-20-12-14-22(15-13-20)28-19(2)3/h4-6,10-15,19H,1,9,16-18H2,2-3H3,(H,25,26) |
| InChIKey | MZMPTQPIAPPCHQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|