C16H19NO4S — CID 121132117
N-(3-hydroxy-3-thiophen-3-ylpropyl)-2-(3-methoxyphenoxy)acetamide (PubChem CID 121132117) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-(3-hydroxy-3-thiophen-3-ylpropyl)-2-(3-methoxyphenoxy)acetamide.
| Compound Name | N-(3-hydroxy-3-thiophen-3-ylpropyl)-2-(3-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 121132117 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-(3-hydroxy-3-thiophen-3-ylpropyl)-2-(3-methoxyphenoxy)acetamide |
| SMILES | COc1cccc(OCC(=O)NCCC(O)c2ccsc2)c1 |
| InChI | InChI=1S/C16H19NO4S/c1-20-13-3-2-4-14(9-13)21-10-16(19)17-7-5-15(18)12-6-8-22-11-12/h2-4,6,8-9,11,15,18H,5,7,10H2,1H3,(H,17,19) |
| InChIKey | LVMXKWSTIWVFMY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |