C21H23NO4S2 — CID 121134278
N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-4-propoxybenzenesulfonamide (PubChem CID 121134278) has the molecular formula C21H23NO4S2 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-4-propoxybenzenesulfonamide.
| Compound Name | N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-4-propoxybenzenesulfonamide |
|---|---|
| PubChem CID | 121134278 |
| Molecular Formula | C21H23NO4S2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-4-propoxybenzenesulfonamide |
| SMILES | CCCOc1ccc(S(=O)(=O)NCc2ccc(C(O)c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C21H23NO4S2/c1-2-14-26-17-8-11-19(12-9-17)28(24,25)22-15-18-10-13-20(27-18)21(23)16-6-4-3-5-7-16/h3-13,21-23H,2,14-15H2,1H3 |
| InChIKey | VSPIVZWWOICTQM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |