C20H23NO3S3 — CID 90583643
4-tert-butyl-N-[[5-[hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]benzenesulfonamide (PubChem CID 90583643) has the molecular formula C20H23NO3S3 and a molecular weight of 421.61 g/mol. Its IUPAC name is 4-tert-butyl-N-[[5-[hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[[5-[hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90583643 |
| Molecular Formula | C20H23NO3S3 |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 4-tert-butyl-N-[[5-[hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCc2ccc(C(O)c3cccs3)s2)cc1 |
| InChI | InChI=1S/C20H23NO3S3/c1-20(2,3)14-6-9-16(10-7-14)27(23,24)21-13-15-8-11-18(26-15)19(22)17-5-4-12-25-17/h4-12,19,21-22H,13H2,1-3H3 |
| InChIKey | FHHHRERMQADTCP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |