C9H12N6O2S — CID 121134990
4-(dimethylsulfamoylamino)-6-pyrazol-1-ylpyrimidine (PubChem CID 121134990) has the molecular formula C9H12N6O2S and a molecular weight of 268.30 g/mol. Its IUPAC name is 4-(dimethylsulfamoylamino)-6-pyrazol-1-ylpyrimidine.
| Compound Name | 4-(dimethylsulfamoylamino)-6-pyrazol-1-ylpyrimidine |
|---|---|
| PubChem CID | 121134990 |
| Molecular Formula | C9H12N6O2S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 4-(dimethylsulfamoylamino)-6-pyrazol-1-ylpyrimidine |
| SMILES | CN(C)S(=O)(=O)Nc1cc(-n2cccn2)ncn1 |
| InChI | InChI=1S/C9H12N6O2S/c1-14(2)18(16,17)13-8-6-9(11-7-10-8)15-5-3-4-12-15/h3-7H,1-2H3,(H,10,11,13) |
| InChIKey | YBGYYIGCQHZHPQ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |