C14H13N5O3S — CID 121135064
3-methoxy-N-(6-pyrazol-1-ylpyrimidin-4-yl)benzenesulfonamide (PubChem CID 121135064) has the molecular formula C14H13N5O3S and a molecular weight of 331.36 g/mol. Its IUPAC name is 3-methoxy-N-(6-pyrazol-1-ylpyrimidin-4-yl)benzenesulfonamide.
| Compound Name | 3-methoxy-N-(6-pyrazol-1-ylpyrimidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 121135064 |
| Molecular Formula | C14H13N5O3S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 3-methoxy-N-(6-pyrazol-1-ylpyrimidin-4-yl)benzenesulfonamide |
| SMILES | COc1cccc(S(=O)(=O)Nc2cc(-n3cccn3)ncn2)c1 |
| InChI | InChI=1S/C14H13N5O3S/c1-22-11-4-2-5-12(8-11)23(20,21)18-13-9-14(16-10-15-13)19-7-3-6-17-19/h2-10H,1H3,(H,15,16,18) |
| InChIKey | ZOEJKZPLKLUGFN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |