C10H10F3N5O — CID 121144997
2,2,2-trifluoro-N-[3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl]acetamide (PubChem CID 121144997) has the molecular formula C10H10F3N5O and a molecular weight of 273.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl]acetamide |
|---|---|
| PubChem CID | 121144997 |
| Molecular Formula | C10H10F3N5O |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl]acetamide |
| SMILES | O=C(NCCCc1cnc2ncnn2c1)C(F)(F)F |
| InChI | InChI=1S/C10H10F3N5O/c11-10(12,13)8(19)14-3-1-2-7-4-15-9-16-6-17-18(9)5-7/h4-6H,1-3H2,(H,14,19) |
| InChIKey | DUXXDHFIPIRRBT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|