C16H23F3N6O — CID 91058059
N,N-dimethyl-7-[4-(methylamino)-2-(trifluoromethyl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]heptanamide (PubChem CID 91058059) has the molecular formula C16H23F3N6O and a molecular weight of 372.40 g/mol. Its IUPAC name is N,N-dimethyl-7-[4-(methylamino)-2-(trifluoromethyl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]heptanamide.
| Compound Name | N,N-dimethyl-7-[4-(methylamino)-2-(trifluoromethyl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]heptanamide |
|---|---|
| PubChem CID | 91058059 |
| Molecular Formula | C16H23F3N6O |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | N,N-dimethyl-7-[4-(methylamino)-2-(trifluoromethyl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]heptanamide |
| SMILES | CNc1nc(C(F)(F)F)nc2c(CCCCCCC(=O)N(C)C)cnn12 |
| InChI | InChI=1S/C16H23F3N6O/c1-20-15-23-14(16(17,18)19)22-13-11(10-21-25(13)15)8-6-4-5-7-9-12(26)24(2)3/h10H,4-9H2,1-3H3,(H,20,22,23) |
| InChIKey | QGYLNRMDZHEQSU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|