C19H20N4O3 — CID 121145260
N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 121145260) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 121145260 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1cnn(CC2CCCCO2)c1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C19H20N4O3/c24-19(17-10-18(26-22-17)14-6-2-1-3-7-14)21-15-11-20-23(12-15)13-16-8-4-5-9-25-16/h1-3,6-7,10-12,16H,4-5,8-9,13H2,(H,21,24) |
| InChIKey | CNFZSPRPHQPTRC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |