C25H29N3O3 — CID 121147108
[3-(4-methoxyphenyl)azepan-1-yl]-[3-(2-methoxyphenyl)-1-methylpyrazol-5-yl]methanone (PubChem CID 121147108) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)azepan-1-yl]-[3-(2-methoxyphenyl)-1-methylpyrazol-5-yl]methanone.
| Compound Name | [3-(4-methoxyphenyl)azepan-1-yl]-[3-(2-methoxyphenyl)-1-methylpyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 121147108 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | [3-(4-methoxyphenyl)azepan-1-yl]-[3-(2-methoxyphenyl)-1-methylpyrazol-5-yl]methanone |
| SMILES | COc1ccc(C2CCCCN(C(=O)c3cc(-c4ccccc4OC)nn3C)C2)cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-27-23(16-22(26-27)21-9-4-5-10-24(21)31-3)25(29)28-15-7-6-8-19(17-28)18-11-13-20(30-2)14-12-18/h4-5,9-14,16,19H,6-8,15,17H2,1-3H3 |
| InChIKey | GOOKHKBEBMLWSA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |