C23H23F2N3O — CID 99979716
[(3S)-3-(4-fluorophenyl)azepan-1-yl]-[3-(4-fluorophenyl)-1-methylpyrazol-5-yl]methanone (PubChem CID 99979716) has the molecular formula C23H23F2N3O and a molecular weight of 395.45 g/mol. Its IUPAC name is [(3S)-3-(4-fluorophenyl)azepan-1-yl]-[3-(4-fluorophenyl)-1-methylpyrazol-5-yl]methanone.
| Compound Name | [(3S)-3-(4-fluorophenyl)azepan-1-yl]-[3-(4-fluorophenyl)-1-methylpyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 99979716 |
| Molecular Formula | C23H23F2N3O |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [(3S)-3-(4-fluorophenyl)azepan-1-yl]-[3-(4-fluorophenyl)-1-methylpyrazol-5-yl]methanone |
| SMILES | Cn1nc(-c2ccc(F)cc2)cc1C(=O)N1CCCC[C@@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C23H23F2N3O/c1-27-22(14-21(26-27)17-7-11-20(25)12-8-17)23(29)28-13-3-2-4-18(15-28)16-5-9-19(24)10-6-16/h5-12,14,18H,2-4,13,15H2,1H3/t18-/m1/s1 |
| InChIKey | MDNDYTUUSJBBSC-GOSISDBHSA-N |
| XLogP | 4.78 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |