C18H27NO4S2 — CID 121152792
N-[2-(oxan-4-ylsulfanyl)ethyl]-2-(4-propan-2-ylsulfonylphenyl)acetamide (PubChem CID 121152792) has the molecular formula C18H27NO4S2 and a molecular weight of 385.55 g/mol. Its IUPAC name is N-[2-(oxan-4-ylsulfanyl)ethyl]-2-(4-propan-2-ylsulfonylphenyl)acetamide.
| Compound Name | N-[2-(oxan-4-ylsulfanyl)ethyl]-2-(4-propan-2-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 121152792 |
| Molecular Formula | C18H27NO4S2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-[2-(oxan-4-ylsulfanyl)ethyl]-2-(4-propan-2-ylsulfonylphenyl)acetamide |
| SMILES | CC(C)S(=O)(=O)c1ccc(CC(=O)NCCSC2CCOCC2)cc1 |
| InChI | InChI=1S/C18H27NO4S2/c1-14(2)25(21,22)17-5-3-15(4-6-17)13-18(20)19-9-12-24-16-7-10-23-11-8-16/h3-6,14,16H,7-13H2,1-2H3,(H,19,20) |
| InChIKey | SBZZSOJFEFPMJR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|