C23H28N4O4S — CID 121153895
1-[1-[4-[(3-methylphenyl)sulfonylamino]benzoyl]azetidin-3-yl]piperidine-4-carboxamide (PubChem CID 121153895) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is 1-[1-[4-[(3-methylphenyl)sulfonylamino]benzoyl]azetidin-3-yl]piperidine-4-carboxamide.
| Compound Name | 1-[1-[4-[(3-methylphenyl)sulfonylamino]benzoyl]azetidin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121153895 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 1-[1-[4-[(3-methylphenyl)sulfonylamino]benzoyl]azetidin-3-yl]piperidine-4-carboxamide |
| SMILES | Cc1cccc(S(=O)(=O)Nc2ccc(C(=O)N3CC(N4CCC(C(N)=O)CC4)C3)cc2)c1 |
| InChI | InChI=1S/C23H28N4O4S/c1-16-3-2-4-21(13-16)32(30,31)25-19-7-5-18(6-8-19)23(29)27-14-20(15-27)26-11-9-17(10-12-26)22(24)28/h2-8,13,17,20,25H,9-12,14-15H2,1H3,(H2,24,28) |
| InChIKey | IIQIBPHNQXNWDX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |