C26H25N5O3S — CID 121149959
3-methyl-N-[4-[3-(4-phenyltriazol-1-yl)pyrrolidine-1-carbonyl]phenyl]benzenesulfonamide (PubChem CID 121149959) has the molecular formula C26H25N5O3S and a molecular weight of 487.59 g/mol. Its IUPAC name is 3-methyl-N-[4-[3-(4-phenyltriazol-1-yl)pyrrolidine-1-carbonyl]phenyl]benzenesulfonamide.
| Compound Name | 3-methyl-N-[4-[3-(4-phenyltriazol-1-yl)pyrrolidine-1-carbonyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121149959 |
| Molecular Formula | C26H25N5O3S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 3-methyl-N-[4-[3-(4-phenyltriazol-1-yl)pyrrolidine-1-carbonyl]phenyl]benzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)Nc2ccc(C(=O)N3CCC(n4cc(-c5ccccc5)nn4)C3)cc2)c1 |
| InChI | InChI=1S/C26H25N5O3S/c1-19-6-5-9-24(16-19)35(33,34)28-22-12-10-21(11-13-22)26(32)30-15-14-23(17-30)31-18-25(27-29-31)20-7-3-2-4-8-20/h2-13,16,18,23,28H,14-15,17H2,1H3 |
| InChIKey | HPDGYMTURXPTSN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |