C15H16N2O4S — CID 121155042
3-[1-[2-(3-methylphenoxy)acetyl]azetidin-3-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 121155042) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is 3-[1-[2-(3-methylphenoxy)acetyl]azetidin-3-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[1-[2-(3-methylphenoxy)acetyl]azetidin-3-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 121155042 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 3-[1-[2-(3-methylphenoxy)acetyl]azetidin-3-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cccc(OCC(=O)N2CC(N3C(=O)CSC3=O)C2)c1 |
| InChI | InChI=1S/C15H16N2O4S/c1-10-3-2-4-12(5-10)21-8-13(18)16-6-11(7-16)17-14(19)9-22-15(17)20/h2-5,11H,6-9H2,1H3 |
| InChIKey | RRUKRVSRWQVPJI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|