C14H13FN2O4S — CID 121155045
3-[1-[2-(4-fluorophenoxy)acetyl]azetidin-3-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 121155045) has the molecular formula C14H13FN2O4S and a molecular weight of 324.33 g/mol. Its IUPAC name is 3-[1-[2-(4-fluorophenoxy)acetyl]azetidin-3-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[1-[2-(4-fluorophenoxy)acetyl]azetidin-3-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 121155045 |
| Molecular Formula | C14H13FN2O4S |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 3-[1-[2-(4-fluorophenoxy)acetyl]azetidin-3-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(COc1ccc(F)cc1)N1CC(N2C(=O)CSC2=O)C1 |
| InChI | InChI=1S/C14H13FN2O4S/c15-9-1-3-11(4-2-9)21-7-12(18)16-5-10(6-16)17-13(19)8-22-14(17)20/h1-4,10H,5-8H2 |
| InChIKey | HRYGLIWEDAFUKU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|