C14H13N3O6S2 — CID 121155375
3-[1-[(3-methyl-2-oxo-1,3-benzoxazol-5-yl)sulfonyl]azetidin-3-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 121155375) has the molecular formula C14H13N3O6S2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 3-[1-[(3-methyl-2-oxo-1,3-benzoxazol-5-yl)sulfonyl]azetidin-3-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[1-[(3-methyl-2-oxo-1,3-benzoxazol-5-yl)sulfonyl]azetidin-3-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 121155375 |
| Molecular Formula | C14H13N3O6S2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 3-[1-[(3-methyl-2-oxo-1,3-benzoxazol-5-yl)sulfonyl]azetidin-3-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cn1c(=O)oc2ccc(S(=O)(=O)N3CC(N4C(=O)CSC4=O)C3)cc21 |
| InChI | InChI=1S/C14H13N3O6S2/c1-15-10-4-9(2-3-11(10)23-13(15)19)25(21,22)16-5-8(6-16)17-12(18)7-24-14(17)20/h2-4,8H,5-7H2,1H3 |
| InChIKey | ZLXXBLJSXQMAJX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 109.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|