C19H17NO6 — CID 121155461
4-[1-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]azetidin-3-yl]oxy-6-methylpyran-2-one (PubChem CID 121155461) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-[1-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]azetidin-3-yl]oxy-6-methylpyran-2-one.
| Compound Name | 4-[1-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]azetidin-3-yl]oxy-6-methylpyran-2-one |
|---|---|
| PubChem CID | 121155461 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-[1-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]azetidin-3-yl]oxy-6-methylpyran-2-one |
| SMILES | Cc1cc(OC2CN(C(=O)/C=C/c3ccc4c(c3)OCO4)C2)cc(=O)o1 |
| InChI | InChI=1S/C19H17NO6/c1-12-6-14(8-19(22)25-12)26-15-9-20(10-15)18(21)5-3-13-2-4-16-17(7-13)24-11-23-16/h2-8,15H,9-11H2,1H3/b5-3+ |
| InChIKey | UCACSLZIMKLLIY-HWKANZROSA-N |
| XLogP | 1.98 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|