C17H20N2O5 — CID 121156494
3-[1-(4-ethoxybenzoyl)piperidin-4-yl]-1,3-oxazolidine-2,4-dione (PubChem CID 121156494) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-[1-(4-ethoxybenzoyl)piperidin-4-yl]-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-[1-(4-ethoxybenzoyl)piperidin-4-yl]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 121156494 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 3-[1-(4-ethoxybenzoyl)piperidin-4-yl]-1,3-oxazolidine-2,4-dione |
| SMILES | CCOc1ccc(C(=O)N2CCC(N3C(=O)COC3=O)CC2)cc1 |
| InChI | InChI=1S/C17H20N2O5/c1-2-23-14-5-3-12(4-6-14)16(21)18-9-7-13(8-10-18)19-15(20)11-24-17(19)22/h3-6,13H,2,7-11H2,1H3 |
| InChIKey | PBZGXAOPTSFDAP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |