C14H16N4O3 — CID 121159564
3-(2,5-dioxoimidazolidin-1-yl)-N-(3-methylphenyl)azetidine-1-carboxamide (PubChem CID 121159564) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 3-(2,5-dioxoimidazolidin-1-yl)-N-(3-methylphenyl)azetidine-1-carboxamide.
| Compound Name | 3-(2,5-dioxoimidazolidin-1-yl)-N-(3-methylphenyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 121159564 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 3-(2,5-dioxoimidazolidin-1-yl)-N-(3-methylphenyl)azetidine-1-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2CC(N3C(=O)CNC3=O)C2)c1 |
| InChI | InChI=1S/C14H16N4O3/c1-9-3-2-4-10(5-9)16-14(21)17-7-11(8-17)18-12(19)6-15-13(18)20/h2-5,11H,6-8H2,1H3,(H,15,20)(H,16,21) |
| InChIKey | ORTFEYFIZPVKMX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|