C19H19N3O3 — CID 121160397
3-[1-(naphthalene-1-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 121160397) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 3-[1-(naphthalene-1-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-(naphthalene-1-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121160397 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 3-[1-(naphthalene-1-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | O=C(c1cccc2ccccc12)N1CCC(N2C(=O)CNC2=O)CC1 |
| InChI | InChI=1S/C19H19N3O3/c23-17-12-20-19(25)22(17)14-8-10-21(11-9-14)18(24)16-7-3-5-13-4-1-2-6-15(13)16/h1-7,14H,8-12H2,(H,20,25) |
| InChIKey | RYLYRWYNCHHUKP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|