C15H16BrN3O4 — CID 121161358
(5-bromofuran-2-yl)-[4-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]methanone (PubChem CID 121161358) has the molecular formula C15H16BrN3O4 and a molecular weight of 382.21 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-[4-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]methanone.
| Compound Name | (5-bromofuran-2-yl)-[4-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 121161358 |
| Molecular Formula | C15H16BrN3O4 |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | (5-bromofuran-2-yl)-[4-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]methanone |
| SMILES | COc1nccc(OC2CCN(C(=O)c3ccc(Br)o3)CC2)n1 |
| InChI | InChI=1S/C15H16BrN3O4/c1-21-15-17-7-4-13(18-15)22-10-5-8-19(9-6-10)14(20)11-2-3-12(16)23-11/h2-4,7,10H,5-6,8-9H2,1H3 |
| InChIKey | LHXJZNVWOXSWAY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |