C16H17BrN2O3 — CID 90566406
(5-bromofuran-2-yl)-[4-[(6-methyl-3-pyridinyl)oxy]piperidin-1-yl]methanone (PubChem CID 90566406) has the molecular formula C16H17BrN2O3 and a molecular weight of 365.23 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-[4-[(6-methyl-3-pyridinyl)oxy]piperidin-1-yl]methanone.
| Compound Name | (5-bromofuran-2-yl)-[4-[(6-methyl-3-pyridinyl)oxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 90566406 |
| Molecular Formula | C16H17BrN2O3 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | (5-bromofuran-2-yl)-[4-[(6-methyl-3-pyridinyl)oxy]piperidin-1-yl]methanone |
| SMILES | Cc1ccc(OC2CCN(C(=O)c3ccc(Br)o3)CC2)cn1 |
| InChI | InChI=1S/C16H17BrN2O3/c1-11-2-3-13(10-18-11)21-12-6-8-19(9-7-12)16(20)14-4-5-15(17)22-14/h2-5,10,12H,6-9H2,1H3 |
| InChIKey | UEZZODNDWJDRKA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |