C16H21N5O3 — CID 121165128
N-(2,3-dimethoxyphenyl)-4-(triazol-2-yl)piperidine-1-carboxamide (PubChem CID 121165128) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is N-(2,3-dimethoxyphenyl)-4-(triazol-2-yl)piperidine-1-carboxamide.
| Compound Name | N-(2,3-dimethoxyphenyl)-4-(triazol-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 121165128 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-(2,3-dimethoxyphenyl)-4-(triazol-2-yl)piperidine-1-carboxamide |
| SMILES | COc1cccc(NC(=O)N2CCC(n3nccn3)CC2)c1OC |
| InChI | InChI=1S/C16H21N5O3/c1-23-14-5-3-4-13(15(14)24-2)19-16(22)20-10-6-12(7-11-20)21-17-8-9-18-21/h3-5,8-9,12H,6-7,10-11H2,1-2H3,(H,19,22) |
| InChIKey | RRYZESQUDIMMPQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |