C16H16N4OS2 — CID 121166113
4-propyl-N-[(2-thiophen-2-yl-3-pyridinyl)methyl]thiadiazole-5-carboxamide (PubChem CID 121166113) has the molecular formula C16H16N4OS2 and a molecular weight of 344.47 g/mol. Its IUPAC name is 4-propyl-N-[(2-thiophen-2-yl-3-pyridinyl)methyl]thiadiazole-5-carboxamide.
| Compound Name | 4-propyl-N-[(2-thiophen-2-yl-3-pyridinyl)methyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 121166113 |
| Molecular Formula | C16H16N4OS2 |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 4-propyl-N-[(2-thiophen-2-yl-3-pyridinyl)methyl]thiadiazole-5-carboxamide |
| SMILES | CCCc1nnsc1C(=O)NCc1cccnc1-c1cccs1 |
| InChI | InChI=1S/C16H16N4OS2/c1-2-5-12-15(23-20-19-12)16(21)18-10-11-6-3-8-17-14(11)13-7-4-9-22-13/h3-4,6-9H,2,5,10H2,1H3,(H,18,21) |
| InChIKey | UIWPRLMXBKPCPR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |