C13H10F3N3O2 — CID 121167635
6-ethoxy-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide (PubChem CID 121167635) has the molecular formula C13H10F3N3O2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 6-ethoxy-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide.
| Compound Name | 6-ethoxy-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 121167635 |
| Molecular Formula | C13H10F3N3O2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 6-ethoxy-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(F)c(F)c2F)ncn1 |
| InChI | InChI=1S/C13H10F3N3O2/c1-2-21-10-5-9(17-6-18-10)13(20)19-8-4-3-7(14)11(15)12(8)16/h3-6H,2H2,1H3,(H,19,20) |
| InChIKey | CSAUIMRUYVLPKR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|