C18H17N7O4 — CID 121168722
N-(2-methoxy-5-nitrophenyl)-1-(6-pyrazol-1-ylpyrimidin-4-yl)azetidine-3-carboxamide (PubChem CID 121168722) has the molecular formula C18H17N7O4 and a molecular weight of 395.38 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-1-(6-pyrazol-1-ylpyrimidin-4-yl)azetidine-3-carboxamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-1-(6-pyrazol-1-ylpyrimidin-4-yl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 121168722 |
| Molecular Formula | C18H17N7O4 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-1-(6-pyrazol-1-ylpyrimidin-4-yl)azetidine-3-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C1CN(c2cc(-n3cccn3)ncn2)C1 |
| InChI | InChI=1S/C18H17N7O4/c1-29-15-4-3-13(25(27)28)7-14(15)22-18(26)12-9-23(10-12)16-8-17(20-11-19-16)24-6-2-5-21-24/h2-8,11-12H,9-10H2,1H3,(H,22,26) |
| InChIKey | PXGGOUGREPRPPU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|