C17H22N6O2 — CID 121176734
3-methoxy-2-methyl-N-[3-methyl-1-(triazol-2-yl)butan-2-yl]indazole-6-carboxamide (PubChem CID 121176734) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 3-methoxy-2-methyl-N-[3-methyl-1-(triazol-2-yl)butan-2-yl]indazole-6-carboxamide.
| Compound Name | 3-methoxy-2-methyl-N-[3-methyl-1-(triazol-2-yl)butan-2-yl]indazole-6-carboxamide |
|---|---|
| PubChem CID | 121176734 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 3-methoxy-2-methyl-N-[3-methyl-1-(triazol-2-yl)butan-2-yl]indazole-6-carboxamide |
| SMILES | COc1c2ccc(C(=O)NC(Cn3nccn3)C(C)C)cc2nn1C |
| InChI | InChI=1S/C17H22N6O2/c1-11(2)15(10-23-18-7-8-19-23)20-16(24)12-5-6-13-14(9-12)21-22(3)17(13)25-4/h5-9,11,15H,10H2,1-4H3,(H,20,24) |
| InChIKey | WREVRGOUBIILNK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |