C20H21N3O2S — CID 121177832
6-(2-methylpropoxy)-N-[(2-thiophen-3-yl-3-pyridinyl)methyl]pyridine-3-carboxamide (PubChem CID 121177832) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 6-(2-methylpropoxy)-N-[(2-thiophen-3-yl-3-pyridinyl)methyl]pyridine-3-carboxamide.
| Compound Name | 6-(2-methylpropoxy)-N-[(2-thiophen-3-yl-3-pyridinyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 121177832 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 6-(2-methylpropoxy)-N-[(2-thiophen-3-yl-3-pyridinyl)methyl]pyridine-3-carboxamide |
| SMILES | CC(C)COc1ccc(C(=O)NCc2cccnc2-c2ccsc2)cn1 |
| InChI | InChI=1S/C20H21N3O2S/c1-14(2)12-25-18-6-5-16(11-22-18)20(24)23-10-15-4-3-8-21-19(15)17-7-9-26-13-17/h3-9,11,13-14H,10,12H2,1-2H3,(H,23,24) |
| InChIKey | YWMOGEUAYMKZFO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |