C20H25NO3S2 — CID 121179119
(E)-N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]-2-phenylethenesulfonamide (PubChem CID 121179119) has the molecular formula C20H25NO3S2 and a molecular weight of 391.56 g/mol. Its IUPAC name is (E)-N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]-2-phenylethenesulfonamide.
| Compound Name | (E)-N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 121179119 |
| Molecular Formula | C20H25NO3S2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | (E)-N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]-2-phenylethenesulfonamide |
| SMILES | CC(O)c1ccc(C2(CNS(=O)(=O)/C=C/c3ccccc3)CCCC2)s1 |
| InChI | InChI=1S/C20H25NO3S2/c1-16(22)18-9-10-19(25-18)20(12-5-6-13-20)15-21-26(23,24)14-11-17-7-3-2-4-8-17/h2-4,7-11,14,16,21-22H,5-6,12-13,15H2,1H3/b14-11+ |
| InChIKey | OHRNAWMYJYRVMI-SDNWHVSQSA-N |
| XLogP | 4.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |