C18H21NO2S2 — CID 86263782
(E)-2-phenyl-N-[(1-thiophen-3-ylcyclopentyl)methyl]ethenesulfonamide (PubChem CID 86263782) has the molecular formula C18H21NO2S2 and a molecular weight of 347.50 g/mol. Its IUPAC name is (E)-2-phenyl-N-[(1-thiophen-3-ylcyclopentyl)methyl]ethenesulfonamide.
| Compound Name | (E)-2-phenyl-N-[(1-thiophen-3-ylcyclopentyl)methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 86263782 |
| Molecular Formula | C18H21NO2S2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (E)-2-phenyl-N-[(1-thiophen-3-ylcyclopentyl)methyl]ethenesulfonamide |
| SMILES | O=S(=O)(/C=C/c1ccccc1)NCC1(c2ccsc2)CCCC1 |
| InChI | InChI=1S/C18H21NO2S2/c20-23(21,13-9-16-6-2-1-3-7-16)19-15-18(10-4-5-11-18)17-8-12-22-14-17/h1-3,6-9,12-14,19H,4-5,10-11,15H2/b13-9+ |
| InChIKey | URCVXWFIIZCOSD-UKTHLTGXSA-N |
| XLogP | 4.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |