C16H19NO2S2 — CID 146078875
2-phenyl-N-[(1-thiophen-3-ylcyclopropyl)methyl]ethanesulfonamide (PubChem CID 146078875) has the molecular formula C16H19NO2S2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 2-phenyl-N-[(1-thiophen-3-ylcyclopropyl)methyl]ethanesulfonamide.
| Compound Name | 2-phenyl-N-[(1-thiophen-3-ylcyclopropyl)methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 146078875 |
| Molecular Formula | C16H19NO2S2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-phenyl-N-[(1-thiophen-3-ylcyclopropyl)methyl]ethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccccc1)NCC1(c2ccsc2)CC1 |
| InChI | InChI=1S/C16H19NO2S2/c18-21(19,11-7-14-4-2-1-3-5-14)17-13-16(8-9-16)15-6-10-20-12-15/h1-6,10,12,17H,7-9,11,13H2 |
| InChIKey | PDIADXAZQBMHOP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |