C12H13NO2S2 — CID 71991634
2-phenyl-N-thiophen-3-ylethanesulfonamide (PubChem CID 71991634) has the molecular formula C12H13NO2S2 and a molecular weight of 267.38 g/mol. Its IUPAC name is 2-phenyl-N-thiophen-3-ylethanesulfonamide.
| Compound Name | 2-phenyl-N-thiophen-3-ylethanesulfonamide |
|---|---|
| PubChem CID | 71991634 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 2-phenyl-N-thiophen-3-ylethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccccc1)Nc1ccsc1 |
| InChI | InChI=1S/C12H13NO2S2/c14-17(15,13-12-6-8-16-10-12)9-7-11-4-2-1-3-5-11/h1-6,8,10,13H,7,9H2 |
| InChIKey | FNYYKVUHYFVVNV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |