C19H25NO2S2 — CID 30943250
2-phenyl-N-[(1-thiophen-2-ylcyclohexyl)methyl]ethanesulfonamide (PubChem CID 30943250) has the molecular formula C19H25NO2S2 and a molecular weight of 363.55 g/mol. Its IUPAC name is 2-phenyl-N-[(1-thiophen-2-ylcyclohexyl)methyl]ethanesulfonamide.
| Compound Name | 2-phenyl-N-[(1-thiophen-2-ylcyclohexyl)methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 30943250 |
| Molecular Formula | C19H25NO2S2 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-phenyl-N-[(1-thiophen-2-ylcyclohexyl)methyl]ethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccccc1)NCC1(c2cccs2)CCCCC1 |
| InChI | InChI=1S/C19H25NO2S2/c21-24(22,15-11-17-8-3-1-4-9-17)20-16-19(12-5-2-6-13-19)18-10-7-14-23-18/h1,3-4,7-10,14,20H,2,5-6,11-13,15-16H2 |
| InChIKey | PCLWADHPZLMIBQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |