C19H20N2O2S2 — CID 86264405
N-[(1-thiophen-3-ylcyclopentyl)methyl]quinoline-8-sulfonamide (PubChem CID 86264405) has the molecular formula C19H20N2O2S2 and a molecular weight of 372.52 g/mol. Its IUPAC name is N-[(1-thiophen-3-ylcyclopentyl)methyl]quinoline-8-sulfonamide.
| Compound Name | N-[(1-thiophen-3-ylcyclopentyl)methyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 86264405 |
| Molecular Formula | C19H20N2O2S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-[(1-thiophen-3-ylcyclopentyl)methyl]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(NCC1(c2ccsc2)CCCC1)c1cccc2cccnc12 |
| InChI | InChI=1S/C19H20N2O2S2/c22-25(23,17-7-3-5-15-6-4-11-20-18(15)17)21-14-19(9-1-2-10-19)16-8-12-24-13-16/h3-8,11-13,21H,1-2,9-10,14H2 |
| InChIKey | XHPAJIWRBRMZRF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |