C20H22F2N2O3S — CID 121179249
N'-(2,5-difluorophenyl)-N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]oxamide (PubChem CID 121179249) has the molecular formula C20H22F2N2O3S and a molecular weight of 408.47 g/mol. Its IUPAC name is N'-(2,5-difluorophenyl)-N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]oxamide.
| Compound Name | N'-(2,5-difluorophenyl)-N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]oxamide |
|---|---|
| PubChem CID | 121179249 |
| Molecular Formula | C20H22F2N2O3S |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N'-(2,5-difluorophenyl)-N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]oxamide |
| SMILES | CC(O)c1ccc(C2(CNC(=O)C(=O)Nc3cc(F)ccc3F)CCCC2)s1 |
| InChI | InChI=1S/C20H22F2N2O3S/c1-12(25)16-6-7-17(28-16)20(8-2-3-9-20)11-23-18(26)19(27)24-15-10-13(21)4-5-14(15)22/h4-7,10,12,25H,2-3,8-9,11H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | BQYPDIFUUZJBPQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|